3-{1-[3-(dibutylamino)-2-hydroxypropyl]-1H-indol-3-yl}-1-phenylprop-2-en-1-one
Chemical Structure Depiction of
3-{1-[3-(dibutylamino)-2-hydroxypropyl]-1H-indol-3-yl}-1-phenylprop-2-en-1-one
3-{1-[3-(dibutylamino)-2-hydroxypropyl]-1H-indol-3-yl}-1-phenylprop-2-en-1-one
Compound characteristics
| Compound ID: | D009-0527 |
| Compound Name: | 3-{1-[3-(dibutylamino)-2-hydroxypropyl]-1H-indol-3-yl}-1-phenylprop-2-en-1-one |
| Molecular Weight: | 432.61 |
| Molecular Formula: | C28 H36 N2 O2 |
| Smiles: | CCCCN(CCCC)CC(Cn1cc(/C=C/C(c2ccccc2)=O)c2ccccc12)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.6886 |
| logD: | 4.318 |
| logSw: | -5.3676 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 35.777 |
| InChI Key: | SDZIJGBMMXHWRM-VWLOTQADSA-N |