1-(4-fluorophenyl)-4-(1-{2-[5-methyl-2-(propan-2-yl)phenoxy]ethyl}-1H-benzimidazol-2-yl)pyrrolidin-2-one
Chemical Structure Depiction of
1-(4-fluorophenyl)-4-(1-{2-[5-methyl-2-(propan-2-yl)phenoxy]ethyl}-1H-benzimidazol-2-yl)pyrrolidin-2-one
1-(4-fluorophenyl)-4-(1-{2-[5-methyl-2-(propan-2-yl)phenoxy]ethyl}-1H-benzimidazol-2-yl)pyrrolidin-2-one
Compound characteristics
| Compound ID: | D011-0613 |
| Compound Name: | 1-(4-fluorophenyl)-4-(1-{2-[5-methyl-2-(propan-2-yl)phenoxy]ethyl}-1H-benzimidazol-2-yl)pyrrolidin-2-one |
| Molecular Weight: | 471.57 |
| Molecular Formula: | C29 H30 F N3 O2 |
| Smiles: | CC(C)c1ccc(C)cc1OCCn1c2ccccc2nc1C1CC(N(C1)c1ccc(cc1)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.7125 |
| logD: | 6.7125 |
| logSw: | -5.487 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 34.128 |
| InChI Key: | CFEOPHBUQXLTPO-OAQYLSRUSA-N |