1-(4-fluorophenyl)-4-{1-[2-(3-methylphenoxy)ethyl]-1H-benzimidazol-2-yl}pyrrolidin-2-one
Chemical Structure Depiction of
1-(4-fluorophenyl)-4-{1-[2-(3-methylphenoxy)ethyl]-1H-benzimidazol-2-yl}pyrrolidin-2-one
1-(4-fluorophenyl)-4-{1-[2-(3-methylphenoxy)ethyl]-1H-benzimidazol-2-yl}pyrrolidin-2-one
Compound characteristics
| Compound ID: | D011-0618 |
| Compound Name: | 1-(4-fluorophenyl)-4-{1-[2-(3-methylphenoxy)ethyl]-1H-benzimidazol-2-yl}pyrrolidin-2-one |
| Molecular Weight: | 429.49 |
| Molecular Formula: | C26 H24 F N3 O2 |
| Smiles: | Cc1cccc(c1)OCCn1c2ccccc2nc1C1CC(N(C1)c1ccc(cc1)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.4861 |
| logD: | 5.4861 |
| logSw: | -5.3475 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 34.042 |
| InChI Key: | UYDVFCMOTNILOQ-LJQANCHMSA-N |