1-(4-fluorophenyl)-4-[1-(3-phenylprop-2-en-1-yl)-1H-benzimidazol-2-yl]pyrrolidin-2-one
Chemical Structure Depiction of
1-(4-fluorophenyl)-4-[1-(3-phenylprop-2-en-1-yl)-1H-benzimidazol-2-yl]pyrrolidin-2-one
1-(4-fluorophenyl)-4-[1-(3-phenylprop-2-en-1-yl)-1H-benzimidazol-2-yl]pyrrolidin-2-one
Compound characteristics
| Compound ID: | D011-0675 |
| Compound Name: | 1-(4-fluorophenyl)-4-[1-(3-phenylprop-2-en-1-yl)-1H-benzimidazol-2-yl]pyrrolidin-2-one |
| Molecular Weight: | 411.48 |
| Molecular Formula: | C26 H22 F N3 O |
| Smiles: | C1C(CN(C1=O)c1ccc(cc1)F)c1nc2ccccc2n1C/C=C/c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.4703 |
| logD: | 5.4703 |
| logSw: | -5.6888 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 26.6238 |
| InChI Key: | IUSPFLWJJBZTTM-HXUWFJFHSA-N |