4-(1-benzyl-1H-benzimidazol-2-yl)-1-(3-chlorophenyl)pyrrolidin-2-one
Chemical Structure Depiction of
4-(1-benzyl-1H-benzimidazol-2-yl)-1-(3-chlorophenyl)pyrrolidin-2-one
4-(1-benzyl-1H-benzimidazol-2-yl)-1-(3-chlorophenyl)pyrrolidin-2-one
Compound characteristics
| Compound ID: | D011-0769 |
| Compound Name: | 4-(1-benzyl-1H-benzimidazol-2-yl)-1-(3-chlorophenyl)pyrrolidin-2-one |
| Molecular Weight: | 401.89 |
| Molecular Formula: | C24 H20 Cl N3 O |
| Smiles: | C1C(CN(C1=O)c1cccc(c1)[Cl])c1nc2ccccc2n1Cc1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3379 |
| logD: | 5.3378 |
| logSw: | -5.8113 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 26.6454 |
| InChI Key: | KSYZYSMJHDUGRK-GOSISDBHSA-N |