1-benzyl-5-bromo-7-methyl-1H-indole-2,3-dione
Chemical Structure Depiction of
1-benzyl-5-bromo-7-methyl-1H-indole-2,3-dione
1-benzyl-5-bromo-7-methyl-1H-indole-2,3-dione
Compound characteristics
| Compound ID: | D011-1109 |
| Compound Name: | 1-benzyl-5-bromo-7-methyl-1H-indole-2,3-dione |
| Molecular Weight: | 330.18 |
| Molecular Formula: | C16 H12 Br N O2 |
| Smiles: | Cc1cc(cc2C(C(N(Cc3ccccc3)c12)=O)=O)[Br] |
| Stereo: | ACHIRAL |
| logP: | 4.493 |
| logD: | 4.493 |
| logSw: | -4.484 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 30.0108 |
| InChI Key: | VUCQUDMHLGZOKW-UHFFFAOYSA-N |