(3aRS,5SR,5aRS,8aSR,8bRS)-N-(3-acetylphenyl)-2,2,7,7-tetramethyltetrahydro-2H,3aH,7H-bis[1,3]dioxolo[4,5-b:4',5'-d]pyran-5-carboxamide
Chemical Structure Depiction of
(3aRS,5SR,5aRS,8aSR,8bRS)-N-(3-acetylphenyl)-2,2,7,7-tetramethyltetrahydro-2H,3aH,7H-bis[1,3]dioxolo[4,5-b:4',5'-d]pyran-5-carboxamide
(3aRS,5SR,5aRS,8aSR,8bRS)-N-(3-acetylphenyl)-2,2,7,7-tetramethyltetrahydro-2H,3aH,7H-bis[1,3]dioxolo[4,5-b:4',5'-d]pyran-5-carboxamide
Compound characteristics
| Compound ID: | D011-1712 |
| Compound Name: | (3aRS,5SR,5aRS,8aSR,8bRS)-N-(3-acetylphenyl)-2,2,7,7-tetramethyltetrahydro-2H,3aH,7H-bis[1,3]dioxolo[4,5-b:4',5'-d]pyran-5-carboxamide |
| Molecular Weight: | 391.42 |
| Molecular Formula: | C20 H25 N O7 |
| Smiles: | CC(c1cccc(c1)NC([C@@H]1[C@H]2[C@@H]([C@@H]3[C@H](O1)OC(C)(C)O3)OC(C)(C)O2)=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 2.3234 |
| logD: | 2.3231 |
| logSw: | -2.9699 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 77.001 |
| InChI Key: | DUCVWAQYDPRPKD-KCYAQADSSA-N |