5-chloro-2-{[(2-methylphenyl)methyl]sulfanyl}-1H-benzimidazole
Chemical Structure Depiction of
5-chloro-2-{[(2-methylphenyl)methyl]sulfanyl}-1H-benzimidazole
5-chloro-2-{[(2-methylphenyl)methyl]sulfanyl}-1H-benzimidazole
Compound characteristics
| Compound ID: | D011-3352 |
| Compound Name: | 5-chloro-2-{[(2-methylphenyl)methyl]sulfanyl}-1H-benzimidazole |
| Molecular Weight: | 288.8 |
| Molecular Formula: | C15 H13 Cl N2 S |
| Smiles: | Cc1ccccc1CSc1nc2cc(ccc2[nH]1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.9355 |
| logD: | 4.8886 |
| logSw: | -4.8627 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 17.9799 |
| InChI Key: | KAMBSLABAFVWAX-UHFFFAOYSA-N |