N-(1-{1-[(4-methylphenyl)methyl]-1H-benzimidazol-2-yl}ethyl)acetamide
Chemical Structure Depiction of
N-(1-{1-[(4-methylphenyl)methyl]-1H-benzimidazol-2-yl}ethyl)acetamide
N-(1-{1-[(4-methylphenyl)methyl]-1H-benzimidazol-2-yl}ethyl)acetamide
Compound characteristics
| Compound ID: | D011-5256 |
| Compound Name: | N-(1-{1-[(4-methylphenyl)methyl]-1H-benzimidazol-2-yl}ethyl)acetamide |
| Molecular Weight: | 307.39 |
| Molecular Formula: | C19 H21 N3 O |
| Smiles: | CC(c1nc2ccccc2n1Cc1ccc(C)cc1)NC(C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.3332 |
| logD: | 3.3325 |
| logSw: | -3.5157 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.914 |
| InChI Key: | ANVAWXZLNRFCNJ-AWEZNQCLSA-N |