N-(1-{1-[(4-methylphenyl)methyl]-1H-benzimidazol-2-yl}ethyl)butanamide
Chemical Structure Depiction of
N-(1-{1-[(4-methylphenyl)methyl]-1H-benzimidazol-2-yl}ethyl)butanamide
N-(1-{1-[(4-methylphenyl)methyl]-1H-benzimidazol-2-yl}ethyl)butanamide
Compound characteristics
| Compound ID: | D011-5264 |
| Compound Name: | N-(1-{1-[(4-methylphenyl)methyl]-1H-benzimidazol-2-yl}ethyl)butanamide |
| Molecular Weight: | 335.45 |
| Molecular Formula: | C21 H25 N3 O |
| Smiles: | CCCC(NC(C)c1nc2ccccc2n1Cc1ccc(C)cc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.4935 |
| logD: | 4.4932 |
| logSw: | -4.208 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.802 |
| InChI Key: | JBDPFVDFISLLNK-INIZCTEOSA-N |