1-(2,4-dimethylphenyl)-4-(1-hexyl-1H-benzimidazol-2-yl)pyrrolidin-2-one--hydrogen chloride (1/1)
Chemical Structure Depiction of
1-(2,4-dimethylphenyl)-4-(1-hexyl-1H-benzimidazol-2-yl)pyrrolidin-2-one--hydrogen chloride (1/1)
1-(2,4-dimethylphenyl)-4-(1-hexyl-1H-benzimidazol-2-yl)pyrrolidin-2-one--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | D011-6234 |
| Compound Name: | 1-(2,4-dimethylphenyl)-4-(1-hexyl-1H-benzimidazol-2-yl)pyrrolidin-2-one--hydrogen chloride (1/1) |
| Molecular Weight: | 426 |
| Molecular Formula: | C25 H31 N3 O |
| Salt: | HCl |
| Smiles: | CCCCCCn1c2ccccc2nc1C1CC(N(C1)c1ccc(C)cc1C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.6758 |
| logD: | 6.6757 |
| logSw: | -5.5288 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 26.5944 |
| InChI Key: | VWIZKHYAWPXRIE-FQEVSTJZSA-N |