N-cyclohexyl-N'-[3-(2,5,6-trimethyl-1H-benzimidazol-1-yl)propyl]urea
Chemical Structure Depiction of
N-cyclohexyl-N'-[3-(2,5,6-trimethyl-1H-benzimidazol-1-yl)propyl]urea
N-cyclohexyl-N'-[3-(2,5,6-trimethyl-1H-benzimidazol-1-yl)propyl]urea
Compound characteristics
| Compound ID: | D012-0178 |
| Compound Name: | N-cyclohexyl-N'-[3-(2,5,6-trimethyl-1H-benzimidazol-1-yl)propyl]urea |
| Molecular Weight: | 342.48 |
| Molecular Formula: | C20 H30 N4 O |
| Smiles: | Cc1cc2c(cc1C)n(CCCNC(NC1CCCCC1)=O)c(C)n2 |
| Stereo: | ACHIRAL |
| logP: | 4.018 |
| logD: | 3.9951 |
| logSw: | -3.9072 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 45.708 |
| InChI Key: | YFPCTYQJCWWJDI-UHFFFAOYSA-N |