1-{5-[3-(dipropylamino)-2-hydroxypropoxy]-2-methyl-1-(4-methylphenyl)-1H-indol-3-yl}ethan-1-one
Chemical Structure Depiction of
1-{5-[3-(dipropylamino)-2-hydroxypropoxy]-2-methyl-1-(4-methylphenyl)-1H-indol-3-yl}ethan-1-one
1-{5-[3-(dipropylamino)-2-hydroxypropoxy]-2-methyl-1-(4-methylphenyl)-1H-indol-3-yl}ethan-1-one
Compound characteristics
| Compound ID: | D016-0540 |
| Compound Name: | 1-{5-[3-(dipropylamino)-2-hydroxypropoxy]-2-methyl-1-(4-methylphenyl)-1H-indol-3-yl}ethan-1-one |
| Molecular Weight: | 436.59 |
| Molecular Formula: | C27 H36 N2 O3 |
| Smiles: | CCCN(CCC)CC(COc1ccc2c(c1)c(C(C)=O)c(C)n2c1ccc(C)cc1)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.34 |
| logD: | 3.8112 |
| logSw: | -5.4016 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.068 |
| InChI Key: | QQCWOKNYDSKEST-QHCPKHFHSA-N |