N-[2-(3-methylanilino)-2-phenylethyl]benzenesulfonamide
Chemical Structure Depiction of
N-[2-(3-methylanilino)-2-phenylethyl]benzenesulfonamide
N-[2-(3-methylanilino)-2-phenylethyl]benzenesulfonamide
Compound characteristics
| Compound ID: | D030-0008 |
| Compound Name: | N-[2-(3-methylanilino)-2-phenylethyl]benzenesulfonamide |
| Molecular Weight: | 366.48 |
| Molecular Formula: | C21 H22 N2 O2 S |
| Smiles: | Cc1cccc(c1)NC(CNS(c1ccccc1)(=O)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.64 |
| logD: | 4.64 |
| logSw: | -4.4674 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 51.862 |
| InChI Key: | OBOYGMGONMDXRP-NRFANRHFSA-N |