N-[2-(2,5-dimethylanilino)-2-phenylethyl]-4-methylbenzene-1-sulfonamide
Chemical Structure Depiction of
N-[2-(2,5-dimethylanilino)-2-phenylethyl]-4-methylbenzene-1-sulfonamide
N-[2-(2,5-dimethylanilino)-2-phenylethyl]-4-methylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | D030-0042 |
| Compound Name: | N-[2-(2,5-dimethylanilino)-2-phenylethyl]-4-methylbenzene-1-sulfonamide |
| Molecular Weight: | 394.53 |
| Molecular Formula: | C23 H26 N2 O2 S |
| Smiles: | Cc1ccc(cc1)S(NCC(c1ccccc1)Nc1cc(C)ccc1C)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.4035 |
| logD: | 5.4034 |
| logSw: | -5.4844 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 51.164 |
| InChI Key: | JMKSCOOVNFKJGE-QHCPKHFHSA-N |