4-chloro-N-[2-(4-fluoroanilino)-2-phenylethyl]benzene-1-sulfonamide
Chemical Structure Depiction of
4-chloro-N-[2-(4-fluoroanilino)-2-phenylethyl]benzene-1-sulfonamide
4-chloro-N-[2-(4-fluoroanilino)-2-phenylethyl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | D030-0080 |
| Compound Name: | 4-chloro-N-[2-(4-fluoroanilino)-2-phenylethyl]benzene-1-sulfonamide |
| Molecular Weight: | 404.89 |
| Molecular Formula: | C20 H18 Cl F N2 O2 S |
| Smiles: | C(C(c1ccccc1)Nc1ccc(cc1)F)NS(c1ccc(cc1)[Cl])(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.2096 |
| logD: | 5.2095 |
| logSw: | -5.9215 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 51.862 |
| InChI Key: | SGLQALGHWKZXNB-FQEVSTJZSA-N |