7-(3-methylphenyl)-2-oxo-2H-1,3-benzoxathiol-5-yl 2-methylbenzoate
					Chemical Structure Depiction of
7-(3-methylphenyl)-2-oxo-2H-1,3-benzoxathiol-5-yl 2-methylbenzoate
			7-(3-methylphenyl)-2-oxo-2H-1,3-benzoxathiol-5-yl 2-methylbenzoate
Compound characteristics
| Compound ID: | D037-0354 | 
| Compound Name: | 7-(3-methylphenyl)-2-oxo-2H-1,3-benzoxathiol-5-yl 2-methylbenzoate | 
| Molecular Weight: | 376.43 | 
| Molecular Formula: | C22 H16 O4 S | 
| Smiles: | Cc1cccc(c1)c1cc(cc2c1OC(=O)S2)OC(c1ccccc1C)=O | 
| Stereo: | ACHIRAL | 
| logP: | 5.7458 | 
| logD: | 5.7458 | 
| logSw: | -5.5995 | 
| Hydrogen bond acceptors count: | 7 | 
| Polar surface area: | 42.101 | 
| InChI Key: | QUARRKMTQSINHO-UHFFFAOYSA-N | 
 
				 
				