1-[4-(diphenylmethyl)piperazin-1-yl]-2-(5-ethyl-1-benzofuran-3-yl)ethan-1-one
Chemical Structure Depiction of
1-[4-(diphenylmethyl)piperazin-1-yl]-2-(5-ethyl-1-benzofuran-3-yl)ethan-1-one
1-[4-(diphenylmethyl)piperazin-1-yl]-2-(5-ethyl-1-benzofuran-3-yl)ethan-1-one
Compound characteristics
| Compound ID: | D038-0208 |
| Compound Name: | 1-[4-(diphenylmethyl)piperazin-1-yl]-2-(5-ethyl-1-benzofuran-3-yl)ethan-1-one |
| Molecular Weight: | 438.57 |
| Molecular Formula: | C29 H30 N2 O2 |
| Smiles: | CCc1ccc2c(c1)c(CC(N1CCN(CC1)C(c1ccccc1)c1ccccc1)=O)co2 |
| Stereo: | ACHIRAL |
| logP: | 5.7901 |
| logD: | 5.7869 |
| logSw: | -5.6322 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 28.4804 |
| InChI Key: | RWIPAMJAUPAJQY-UHFFFAOYSA-N |