N-[4-(azepane-1-sulfonyl)phenyl]-2-(5-methyl-1-benzofuran-3-yl)acetamide
Chemical Structure Depiction of
N-[4-(azepane-1-sulfonyl)phenyl]-2-(5-methyl-1-benzofuran-3-yl)acetamide
N-[4-(azepane-1-sulfonyl)phenyl]-2-(5-methyl-1-benzofuran-3-yl)acetamide
Compound characteristics
| Compound ID: | D038-0475 |
| Compound Name: | N-[4-(azepane-1-sulfonyl)phenyl]-2-(5-methyl-1-benzofuran-3-yl)acetamide |
| Molecular Weight: | 426.53 |
| Molecular Formula: | C23 H26 N2 O4 S |
| Smiles: | [H]N(C(Cc1coc2ccc(C)cc12)=O)c1ccc(cc1)S(N1CCCCCC1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4156 |
| logD: | 4.4137 |
| logSw: | -4.2099 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.718 |
| InChI Key: | JGJPJVMRKFFYCO-UHFFFAOYSA-N |