3-[2-(5-ethyl-1-benzofuran-3-yl)acetamido]-N-(4-methoxyphenyl)-1-benzofuran-2-carboxamide
Chemical Structure Depiction of
3-[2-(5-ethyl-1-benzofuran-3-yl)acetamido]-N-(4-methoxyphenyl)-1-benzofuran-2-carboxamide
3-[2-(5-ethyl-1-benzofuran-3-yl)acetamido]-N-(4-methoxyphenyl)-1-benzofuran-2-carboxamide
Compound characteristics
| Compound ID: | D038-0627 |
| Compound Name: | 3-[2-(5-ethyl-1-benzofuran-3-yl)acetamido]-N-(4-methoxyphenyl)-1-benzofuran-2-carboxamide |
| Molecular Weight: | 468.51 |
| Molecular Formula: | C28 H24 N2 O5 |
| Smiles: | [H]N(C(Cc1coc2ccc(CC)cc12)=O)c1c2ccccc2oc1C(Nc1ccc(cc1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 5.536 |
| logD: | 5.534 |
| logSw: | -5.7758 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 70.441 |
| InChI Key: | TWUANASCFJAWIS-UHFFFAOYSA-N |