ethyl 5-{[4-(4-fluorophenyl)piperazine-1-carbonyl]amino}-2,6-dimethylpyridine-3-carboxylate
Chemical Structure Depiction of
ethyl 5-{[4-(4-fluorophenyl)piperazine-1-carbonyl]amino}-2,6-dimethylpyridine-3-carboxylate
ethyl 5-{[4-(4-fluorophenyl)piperazine-1-carbonyl]amino}-2,6-dimethylpyridine-3-carboxylate
Compound characteristics
| Compound ID: | D039-3002 |
| Compound Name: | ethyl 5-{[4-(4-fluorophenyl)piperazine-1-carbonyl]amino}-2,6-dimethylpyridine-3-carboxylate |
| Molecular Weight: | 400.45 |
| Molecular Formula: | C21 H25 F N4 O3 |
| Smiles: | CCOC(c1cc(c(C)nc1C)NC(N1CCN(CC1)c1ccc(cc1)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6556 |
| logD: | 3.6554 |
| logSw: | -3.8108 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.793 |
| InChI Key: | RJLCQEUQXBSHOU-UHFFFAOYSA-N |