2-methoxy-3-[5-(3,4,5-triethoxyphenyl)-1,2,4-oxadiazol-3-yl]quinoline
Chemical Structure Depiction of
2-methoxy-3-[5-(3,4,5-triethoxyphenyl)-1,2,4-oxadiazol-3-yl]quinoline
2-methoxy-3-[5-(3,4,5-triethoxyphenyl)-1,2,4-oxadiazol-3-yl]quinoline
Compound characteristics
| Compound ID: | D042-0365 |
| Compound Name: | 2-methoxy-3-[5-(3,4,5-triethoxyphenyl)-1,2,4-oxadiazol-3-yl]quinoline |
| Molecular Weight: | 435.48 |
| Molecular Formula: | C24 H25 N3 O5 |
| Smiles: | CCOc1cc(cc(c1OCC)OCC)c1nc(c2cc3ccccc3nc2OC)no1 |
| Stereo: | ACHIRAL |
| logP: | 5.3181 |
| logD: | 5.3181 |
| logSw: | -6.1013 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 69.994 |
| InChI Key: | BOVSMBNVBAREAH-UHFFFAOYSA-N |