N-(3,4-dimethylphenyl)-N-[(2-hydroxy-6-methoxyquinolin-3-yl)methyl]benzenesulfonamide
Chemical Structure Depiction of
N-(3,4-dimethylphenyl)-N-[(2-hydroxy-6-methoxyquinolin-3-yl)methyl]benzenesulfonamide
N-(3,4-dimethylphenyl)-N-[(2-hydroxy-6-methoxyquinolin-3-yl)methyl]benzenesulfonamide
Compound characteristics
| Compound ID: | D042-0450 |
| Compound Name: | N-(3,4-dimethylphenyl)-N-[(2-hydroxy-6-methoxyquinolin-3-yl)methyl]benzenesulfonamide |
| Molecular Weight: | 448.54 |
| Molecular Formula: | C25 H24 N2 O4 S |
| Smiles: | Cc1ccc(cc1C)N(Cc1cc2cc(ccc2nc1O)OC)S(c1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.4861 |
| logD: | 5.4744 |
| logSw: | -5.6635 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.627 |
| InChI Key: | VJFBCDFHBVMQLT-UHFFFAOYSA-N |