methyl (2-amino-5-methyl-7-oxo-4,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetate
Chemical Structure Depiction of
methyl (2-amino-5-methyl-7-oxo-4,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetate
methyl (2-amino-5-methyl-7-oxo-4,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetate
Compound characteristics
| Compound ID: | D043-0311 |
| Compound Name: | methyl (2-amino-5-methyl-7-oxo-4,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetate |
| Molecular Weight: | 237.21 |
| Molecular Formula: | C9 H11 N5 O3 |
| Smiles: | CC1=C(CC(=O)OC)C(n2c(N1)nc(N)n2)=O |
| Stereo: | ACHIRAL |
| logP: | -0.5248 |
| logD: | -0.5756 |
| logSw: | -0.8332 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 91.568 |
| InChI Key: | SVZGYVVAVMLQQS-UHFFFAOYSA-N |