N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N-[(3-methylthiophen-2-yl)methyl]-4-propoxybenzamide
Chemical Structure Depiction of
N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N-[(3-methylthiophen-2-yl)methyl]-4-propoxybenzamide
N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N-[(3-methylthiophen-2-yl)methyl]-4-propoxybenzamide
Compound characteristics
| Compound ID: | D051-0044 |
| Compound Name: | N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N-[(3-methylthiophen-2-yl)methyl]-4-propoxybenzamide |
| Molecular Weight: | 407.55 |
| Molecular Formula: | C20 H25 N O4 S2 |
| Smiles: | CCCOc1ccc(cc1)C(N(Cc1c(C)ccs1)C1CCS(C1)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.3645 |
| logD: | 3.3645 |
| logSw: | -3.3543 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 52.296 |
| InChI Key: | PKDSYRCHFACJLD-QGZVFWFLSA-N |