2-(3,4-dimethylphenoxy)-N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N-[(5-methylfuran-2-yl)methyl]acetamide
Chemical Structure Depiction of
2-(3,4-dimethylphenoxy)-N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N-[(5-methylfuran-2-yl)methyl]acetamide
2-(3,4-dimethylphenoxy)-N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N-[(5-methylfuran-2-yl)methyl]acetamide
Compound characteristics
| Compound ID: | D051-0174 |
| Compound Name: | 2-(3,4-dimethylphenoxy)-N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N-[(5-methylfuran-2-yl)methyl]acetamide |
| Molecular Weight: | 391.48 |
| Molecular Formula: | C20 H25 N O5 S |
| Smiles: | Cc1ccc(cc1C)OCC(N(Cc1ccc(C)o1)C1CCS(C1)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.7114 |
| logD: | 2.7114 |
| logSw: | -3.0525 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 58.094 |
| InChI Key: | VCGJNCHGEYQXAC-QGZVFWFLSA-N |