2-(2-chlorophenoxy)-N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N-[(5-methylfuran-2-yl)methyl]propanamide
Chemical Structure Depiction of
2-(2-chlorophenoxy)-N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N-[(5-methylfuran-2-yl)methyl]propanamide
2-(2-chlorophenoxy)-N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N-[(5-methylfuran-2-yl)methyl]propanamide
Compound characteristics
| Compound ID: | D051-0176 |
| Compound Name: | 2-(2-chlorophenoxy)-N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N-[(5-methylfuran-2-yl)methyl]propanamide |
| Molecular Weight: | 411.9 |
| Molecular Formula: | C19 H22 Cl N O5 S |
| Smiles: | CC(C(N(Cc1ccc(C)o1)C1CCS(C1)(=O)=O)=O)Oc1ccccc1[Cl] |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 2.8691 |
| logD: | 2.8691 |
| logSw: | -3.2531 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 57.998 |
| InChI Key: | ZGTCBMQTCZURDR-UHFFFAOYSA-N |