5-chloro-2-(ethanesulfonyl)-N-(2-fluorophenyl)pyrimidine-4-carboxamide
Chemical Structure Depiction of
5-chloro-2-(ethanesulfonyl)-N-(2-fluorophenyl)pyrimidine-4-carboxamide
5-chloro-2-(ethanesulfonyl)-N-(2-fluorophenyl)pyrimidine-4-carboxamide
Compound characteristics
| Compound ID: | D053-0084 |
| Compound Name: | 5-chloro-2-(ethanesulfonyl)-N-(2-fluorophenyl)pyrimidine-4-carboxamide |
| Molecular Weight: | 343.76 |
| Molecular Formula: | C13 H11 Cl F N3 O3 S |
| Smiles: | [H]N(C(c1c(cnc(n1)S(CC)(=O)=O)[Cl])=O)c1ccccc1F |
| Stereo: | ACHIRAL |
| logP: | 2.2989 |
| logD: | 1.7582 |
| logSw: | -3.1656 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.081 |
| InChI Key: | LERSPPOEXZEBSC-UHFFFAOYSA-N |