5-chloro-2-(methanesulfonyl)-N-[2-(4-sulfamoylphenyl)ethyl]pyrimidine-4-carboxamide
Chemical Structure Depiction of
5-chloro-2-(methanesulfonyl)-N-[2-(4-sulfamoylphenyl)ethyl]pyrimidine-4-carboxamide
5-chloro-2-(methanesulfonyl)-N-[2-(4-sulfamoylphenyl)ethyl]pyrimidine-4-carboxamide
Compound characteristics
| Compound ID: | D053-0270 |
| Compound Name: | 5-chloro-2-(methanesulfonyl)-N-[2-(4-sulfamoylphenyl)ethyl]pyrimidine-4-carboxamide |
| Molecular Weight: | 418.88 |
| Molecular Formula: | C14 H15 Cl N4 O5 S2 |
| Smiles: | [H]N(CCc1ccc(cc1)S(N)(=O)=O)C(c1c(cnc(n1)S(C)(=O)=O)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | -0.4446 |
| logD: | -0.4453 |
| logSw: | -2.4422 |
| Hydrogen bond acceptors count: | 13 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 124.258 |
| InChI Key: | HOWDZFUGLGYLBL-UHFFFAOYSA-N |