5-chloro-N-(3-chloro-4-methoxyphenyl)-2-(ethylsulfanyl)pyrimidine-4-carboxamide
Chemical Structure Depiction of
5-chloro-N-(3-chloro-4-methoxyphenyl)-2-(ethylsulfanyl)pyrimidine-4-carboxamide
5-chloro-N-(3-chloro-4-methoxyphenyl)-2-(ethylsulfanyl)pyrimidine-4-carboxamide
Compound characteristics
| Compound ID: | D054-0103 |
| Compound Name: | 5-chloro-N-(3-chloro-4-methoxyphenyl)-2-(ethylsulfanyl)pyrimidine-4-carboxamide |
| Molecular Weight: | 358.24 |
| Molecular Formula: | C14 H13 Cl2 N3 O2 S |
| Smiles: | [H]N(C(c1c(cnc(n1)SCC)[Cl])=O)c1ccc(c(c1)[Cl])OC |
| Stereo: | ACHIRAL |
| logP: | 4.2485 |
| logD: | 4.1017 |
| logSw: | -4.4342 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.545 |
| InChI Key: | XLJKFQMEPAXHGG-UHFFFAOYSA-N |