ethyl 4-{[5-chloro-2-(ethylsulfanyl)pyrimidine-4-carbonyl]amino}benzoate
Chemical Structure Depiction of
ethyl 4-{[5-chloro-2-(ethylsulfanyl)pyrimidine-4-carbonyl]amino}benzoate
ethyl 4-{[5-chloro-2-(ethylsulfanyl)pyrimidine-4-carbonyl]amino}benzoate
Compound characteristics
| Compound ID: | D054-0114 |
| Compound Name: | ethyl 4-{[5-chloro-2-(ethylsulfanyl)pyrimidine-4-carbonyl]amino}benzoate |
| Molecular Weight: | 365.84 |
| Molecular Formula: | C16 H16 Cl N3 O3 S |
| Smiles: | [H]N(C(c1c(cnc(n1)SCC)[Cl])=O)c1ccc(cc1)C(=O)OCC |
| Stereo: | ACHIRAL |
| logP: | 4.3393 |
| logD: | 4.2888 |
| logSw: | -4.3513 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.669 |
| InChI Key: | SFGXCQILTBFEQY-UHFFFAOYSA-N |