dimethyl [5-{[(furan-2-yl)methyl]amino}-2-(naphthalen-1-yl)-1,3-oxazol-4-yl]phosphonate
Chemical Structure Depiction of
dimethyl [5-{[(furan-2-yl)methyl]amino}-2-(naphthalen-1-yl)-1,3-oxazol-4-yl]phosphonate
dimethyl [5-{[(furan-2-yl)methyl]amino}-2-(naphthalen-1-yl)-1,3-oxazol-4-yl]phosphonate
Compound characteristics
| Compound ID: | D055-0107 |
| Compound Name: | dimethyl [5-{[(furan-2-yl)methyl]amino}-2-(naphthalen-1-yl)-1,3-oxazol-4-yl]phosphonate |
| Molecular Weight: | 398.35 |
| Molecular Formula: | C20 H19 N2 O5 P |
| Smiles: | COP(c1c(NCc2ccco2)oc(c2cccc3ccccc23)n1)(=O)OC |
| Stereo: | ACHIRAL |
| logP: | 3.1317 |
| logD: | 3.1317 |
| logSw: | -3.352 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.652 |
| InChI Key: | ZNACBWPDOQAKRO-UHFFFAOYSA-N |