dimethyl (2-[(4-chlorophenyl)methyl]-5-{[2-(4-methoxyphenyl)ethyl]amino}-1,3-oxazol-4-yl)phosphonate
Chemical Structure Depiction of
dimethyl (2-[(4-chlorophenyl)methyl]-5-{[2-(4-methoxyphenyl)ethyl]amino}-1,3-oxazol-4-yl)phosphonate
dimethyl (2-[(4-chlorophenyl)methyl]-5-{[2-(4-methoxyphenyl)ethyl]amino}-1,3-oxazol-4-yl)phosphonate
Compound characteristics
| Compound ID: | D055-0145 |
| Compound Name: | dimethyl (2-[(4-chlorophenyl)methyl]-5-{[2-(4-methoxyphenyl)ethyl]amino}-1,3-oxazol-4-yl)phosphonate |
| Molecular Weight: | 450.86 |
| Molecular Formula: | C21 H24 Cl N2 O5 P |
| Smiles: | COc1ccc(CCNc2c(nc(Cc3ccc(cc3)[Cl])o2)P(=O)(OC)OC)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.3164 |
| logD: | 3.3164 |
| logSw: | -3.7785 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.226 |
| InChI Key: | MHPKBPJDBYVDIL-UHFFFAOYSA-N |