dimethyl [5-(morpholin-4-yl)-2-(3-nitrophenyl)-1,3-oxazol-4-yl]phosphonate
Chemical Structure Depiction of
dimethyl [5-(morpholin-4-yl)-2-(3-nitrophenyl)-1,3-oxazol-4-yl]phosphonate
dimethyl [5-(morpholin-4-yl)-2-(3-nitrophenyl)-1,3-oxazol-4-yl]phosphonate
Compound characteristics
| Compound ID: | D055-0178 |
| Compound Name: | dimethyl [5-(morpholin-4-yl)-2-(3-nitrophenyl)-1,3-oxazol-4-yl]phosphonate |
| Molecular Weight: | 383.3 |
| Molecular Formula: | C15 H18 N3 O7 P |
| Smiles: | COP(c1c(N2CCOCC2)oc(c2cccc(c2)[N+]([O-])=O)n1)(=O)OC |
| Stereo: | ACHIRAL |
| logP: | 1.2053 |
| logD: | 1.2053 |
| logSw: | -1.9254 |
| Hydrogen bond acceptors count: | 11 |
| Polar surface area: | 92.942 |
| InChI Key: | LFKCBWSLPCGTBF-UHFFFAOYSA-N |