diethyl [5-{[(4-methoxyphenyl)methyl]amino}-2-(naphthalen-1-yl)-1,3-oxazol-4-yl]phosphonate
Chemical Structure Depiction of
diethyl [5-{[(4-methoxyphenyl)methyl]amino}-2-(naphthalen-1-yl)-1,3-oxazol-4-yl]phosphonate
diethyl [5-{[(4-methoxyphenyl)methyl]amino}-2-(naphthalen-1-yl)-1,3-oxazol-4-yl]phosphonate
Compound characteristics
| Compound ID: | D055-0315 |
| Compound Name: | diethyl [5-{[(4-methoxyphenyl)methyl]amino}-2-(naphthalen-1-yl)-1,3-oxazol-4-yl]phosphonate |
| Molecular Weight: | 466.47 |
| Molecular Formula: | C25 H27 N2 O5 P |
| Smiles: | CCOP(c1c(NCc2ccc(cc2)OC)oc(c2cccc3ccccc23)n1)(=O)OCC |
| Stereo: | ACHIRAL |
| logP: | 4.3019 |
| logD: | 4.3019 |
| logSw: | -4.5198 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.222 |
| InChI Key: | ZKTSGGLGUCHGCS-UHFFFAOYSA-N |