diethyl [5-{[(2-chlorophenyl)methyl]amino}-2-(3,4-dimethoxyphenyl)-1,3-oxazol-4-yl]phosphonate
Chemical Structure Depiction of
diethyl [5-{[(2-chlorophenyl)methyl]amino}-2-(3,4-dimethoxyphenyl)-1,3-oxazol-4-yl]phosphonate
diethyl [5-{[(2-chlorophenyl)methyl]amino}-2-(3,4-dimethoxyphenyl)-1,3-oxazol-4-yl]phosphonate
Compound characteristics
| Compound ID: | D055-0389 |
| Compound Name: | diethyl [5-{[(2-chlorophenyl)methyl]amino}-2-(3,4-dimethoxyphenyl)-1,3-oxazol-4-yl]phosphonate |
| Molecular Weight: | 480.88 |
| Molecular Formula: | C22 H26 Cl N2 O6 P |
| Smiles: | CCOP(c1c(NCc2ccccc2[Cl])oc(c2ccc(c(c2)OC)OC)n1)(=O)OCC |
| Stereo: | ACHIRAL |
| logP: | 3.7715 |
| logD: | 3.7715 |
| logSw: | -4.307 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 74.21 |
| InChI Key: | ZGJJHQLKAQOVAF-UHFFFAOYSA-N |