2-{[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]sulfanyl}-6-propylpyrimidin-4(3H)-one
Chemical Structure Depiction of
2-{[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]sulfanyl}-6-propylpyrimidin-4(3H)-one
2-{[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]sulfanyl}-6-propylpyrimidin-4(3H)-one
Compound characteristics
| Compound ID: | D058-0180 |
| Compound Name: | 2-{[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]sulfanyl}-6-propylpyrimidin-4(3H)-one |
| Molecular Weight: | 372.49 |
| Molecular Formula: | C19 H24 N4 O2 S |
| Smiles: | CCCC1=CC(NC(=N1)SCC(N1CCN(CC1)c1ccccc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3634 |
| logD: | 1.6581 |
| logSw: | -2.701 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.56 |
| InChI Key: | IJGAMVCFVGMKOV-UHFFFAOYSA-N |