N-[(4-chlorophenyl)methyl]-N-[(furan-2-yl)methyl]-2-(2,4,6-trimethylphenoxy)acetamide
Chemical Structure Depiction of
N-[(4-chlorophenyl)methyl]-N-[(furan-2-yl)methyl]-2-(2,4,6-trimethylphenoxy)acetamide
N-[(4-chlorophenyl)methyl]-N-[(furan-2-yl)methyl]-2-(2,4,6-trimethylphenoxy)acetamide
Compound characteristics
| Compound ID: | D062-0135 |
| Compound Name: | N-[(4-chlorophenyl)methyl]-N-[(furan-2-yl)methyl]-2-(2,4,6-trimethylphenoxy)acetamide |
| Molecular Weight: | 397.9 |
| Molecular Formula: | C23 H24 Cl N O3 |
| Smiles: | Cc1cc(C)c(c(C)c1)OCC(N(Cc1ccc(cc1)[Cl])Cc1ccco1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5669 |
| logD: | 5.5669 |
| logSw: | -5.9193 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.0717 |
| InChI Key: | CTTSPUNIHOOTIN-UHFFFAOYSA-N |