2-(4-chloro-2-methylphenoxy)-N-{[4-(dimethylamino)phenyl]methyl}-N-[(furan-2-yl)methyl]acetamide
Chemical Structure Depiction of
2-(4-chloro-2-methylphenoxy)-N-{[4-(dimethylamino)phenyl]methyl}-N-[(furan-2-yl)methyl]acetamide
2-(4-chloro-2-methylphenoxy)-N-{[4-(dimethylamino)phenyl]methyl}-N-[(furan-2-yl)methyl]acetamide
Compound characteristics
| Compound ID: | D062-0262 |
| Compound Name: | 2-(4-chloro-2-methylphenoxy)-N-{[4-(dimethylamino)phenyl]methyl}-N-[(furan-2-yl)methyl]acetamide |
| Molecular Weight: | 412.92 |
| Molecular Formula: | C23 H25 Cl N2 O3 |
| Smiles: | Cc1cc(ccc1OCC(N(Cc1ccc(cc1)N(C)C)Cc1ccco1)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.0113 |
| logD: | 4.9959 |
| logSw: | -5.0938 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 33.79 |
| InChI Key: | SBHANSPPYYDXSZ-UHFFFAOYSA-N |