2-chloro-N-[(3-chlorophenyl)methyl]-N-[(furan-2-yl)methyl]benzamide
Chemical Structure Depiction of
2-chloro-N-[(3-chlorophenyl)methyl]-N-[(furan-2-yl)methyl]benzamide
2-chloro-N-[(3-chlorophenyl)methyl]-N-[(furan-2-yl)methyl]benzamide
Compound characteristics
| Compound ID: | D062-0531 |
| Compound Name: | 2-chloro-N-[(3-chlorophenyl)methyl]-N-[(furan-2-yl)methyl]benzamide |
| Molecular Weight: | 360.24 |
| Molecular Formula: | C19 H15 Cl2 N O2 |
| Smiles: | C(c1cccc(c1)[Cl])N(Cc1ccco1)C(c1ccccc1[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.6754 |
| logD: | 4.6754 |
| logSw: | -4.8789 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 23.9267 |
| InChI Key: | LVJPFTMEHUHZBA-UHFFFAOYSA-N |