N-[(3-chlorophenyl)methyl]-N-[(furan-2-yl)methyl]-2-(4-nitrophenoxy)acetamide
Chemical Structure Depiction of
N-[(3-chlorophenyl)methyl]-N-[(furan-2-yl)methyl]-2-(4-nitrophenoxy)acetamide
N-[(3-chlorophenyl)methyl]-N-[(furan-2-yl)methyl]-2-(4-nitrophenoxy)acetamide
Compound characteristics
| Compound ID: | D062-0563 |
| Compound Name: | N-[(3-chlorophenyl)methyl]-N-[(furan-2-yl)methyl]-2-(4-nitrophenoxy)acetamide |
| Molecular Weight: | 400.82 |
| Molecular Formula: | C20 H17 Cl N2 O5 |
| Smiles: | C(c1cccc(c1)[Cl])N(Cc1ccco1)C(COc1ccc(cc1)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9997 |
| logD: | 3.9997 |
| logSw: | -4.3986 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 64.28 |
| InChI Key: | CRCYGPRFSGQHOS-UHFFFAOYSA-N |