N-[(furan-2-yl)methyl]-3-methyl-N-[(4-methylphenyl)methyl]-1-benzofuran-2-carboxamide
Chemical Structure Depiction of
N-[(furan-2-yl)methyl]-3-methyl-N-[(4-methylphenyl)methyl]-1-benzofuran-2-carboxamide
N-[(furan-2-yl)methyl]-3-methyl-N-[(4-methylphenyl)methyl]-1-benzofuran-2-carboxamide
Compound characteristics
| Compound ID: | D062-0796 |
| Compound Name: | N-[(furan-2-yl)methyl]-3-methyl-N-[(4-methylphenyl)methyl]-1-benzofuran-2-carboxamide |
| Molecular Weight: | 359.42 |
| Molecular Formula: | C23 H21 N O3 |
| Smiles: | Cc1ccc(CN(Cc2ccco2)C(c2c(C)c3ccccc3o2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.4099 |
| logD: | 5.4099 |
| logSw: | -5.6378 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 32.452 |
| InChI Key: | RSTBELBGVGBZII-UHFFFAOYSA-N |