1'-ethyl-7-fluoro-2-(3-methoxypropyl)-2H-spiro[[1]benzopyrano[2,3-c]pyrrole-1,3'-indole]-2',3,9(1'H)-trione
Chemical Structure Depiction of
1'-ethyl-7-fluoro-2-(3-methoxypropyl)-2H-spiro[[1]benzopyrano[2,3-c]pyrrole-1,3'-indole]-2',3,9(1'H)-trione
1'-ethyl-7-fluoro-2-(3-methoxypropyl)-2H-spiro[[1]benzopyrano[2,3-c]pyrrole-1,3'-indole]-2',3,9(1'H)-trione
Compound characteristics
| Compound ID: | D063-1039 |
| Compound Name: | 1'-ethyl-7-fluoro-2-(3-methoxypropyl)-2H-spiro[[1]benzopyrano[2,3-c]pyrrole-1,3'-indole]-2',3,9(1'H)-trione |
| Molecular Weight: | 436.44 |
| Molecular Formula: | C24 H21 F N2 O5 |
| Smiles: | CCN1C(C2(C3=C(C(N2CCCOC)=O)Oc2ccc(cc2C3=O)F)c2ccccc12)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.1062 |
| logD: | 3.1062 |
| logSw: | -3.5968 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 60.224 |
| InChI Key: | YBSZBICHFMPGHZ-DEOSSOPVSA-N |