2-(2-hydroxyethyl)-1',7-dimethyl-2H-spiro[[1]benzopyrano[2,3-c]pyrrole-1,3'-indole]-2',3,9(1'H)-trione
Chemical Structure Depiction of
2-(2-hydroxyethyl)-1',7-dimethyl-2H-spiro[[1]benzopyrano[2,3-c]pyrrole-1,3'-indole]-2',3,9(1'H)-trione
2-(2-hydroxyethyl)-1',7-dimethyl-2H-spiro[[1]benzopyrano[2,3-c]pyrrole-1,3'-indole]-2',3,9(1'H)-trione
Compound characteristics
| Compound ID: | D063-1160 |
| Compound Name: | 2-(2-hydroxyethyl)-1',7-dimethyl-2H-spiro[[1]benzopyrano[2,3-c]pyrrole-1,3'-indole]-2',3,9(1'H)-trione |
| Molecular Weight: | 390.39 |
| Molecular Formula: | C22 H18 N2 O5 |
| Smiles: | Cc1ccc2c(c1)C(C1=C(C(N(CCO)C13C(N(C)c1ccccc13)=O)=O)O2)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.7315 |
| logD: | 1.7315 |
| logSw: | -2.6862 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.578 |
| InChI Key: | KACISFHIEWTRNM-QFIPXVFZSA-N |