3-(3-chlorophenyl)-6-(2,3-dihydro-1,4-benzodioxin-2-yl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
Chemical Structure Depiction of
3-(3-chlorophenyl)-6-(2,3-dihydro-1,4-benzodioxin-2-yl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
3-(3-chlorophenyl)-6-(2,3-dihydro-1,4-benzodioxin-2-yl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
Compound characteristics
| Compound ID: | D064-0074 |
| Compound Name: | 3-(3-chlorophenyl)-6-(2,3-dihydro-1,4-benzodioxin-2-yl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| Molecular Weight: | 370.81 |
| Molecular Formula: | C17 H11 Cl N4 O2 S |
| Smiles: | C1C(c2nn3c(c4cccc(c4)[Cl])nnc3s2)Oc2ccccc2O1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1412 |
| logD: | 4.1412 |
| logSw: | -4.549 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 49.159 |
| InChI Key: | GVHQSDCKLNMOMF-AWEZNQCLSA-N |