3-(2,3-dihydro-1,4-benzodioxin-2-yl)-6-[(4-fluorophenoxy)methyl][1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
Chemical Structure Depiction of
3-(2,3-dihydro-1,4-benzodioxin-2-yl)-6-[(4-fluorophenoxy)methyl][1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
3-(2,3-dihydro-1,4-benzodioxin-2-yl)-6-[(4-fluorophenoxy)methyl][1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
Compound characteristics
| Compound ID: | D064-0299 |
| Compound Name: | 3-(2,3-dihydro-1,4-benzodioxin-2-yl)-6-[(4-fluorophenoxy)methyl][1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| Molecular Weight: | 384.39 |
| Molecular Formula: | C18 H13 F N4 O3 S |
| Smiles: | C1C(c2nnc3n2nc(COc2ccc(cc2)F)s3)Oc2ccccc2O1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.1921 |
| logD: | 3.1921 |
| logSw: | -3.2952 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 57.153 |
| InChI Key: | VRRZTXBGDNNYLV-HNNXBMFYSA-N |