1-({6-[2-(4-methoxyphenyl)ethenyl][1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl}methyl)-1H-benzotriazole
Chemical Structure Depiction of
1-({6-[2-(4-methoxyphenyl)ethenyl][1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl}methyl)-1H-benzotriazole
1-({6-[2-(4-methoxyphenyl)ethenyl][1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl}methyl)-1H-benzotriazole
Compound characteristics
| Compound ID: | D064-0413 |
| Compound Name: | 1-({6-[2-(4-methoxyphenyl)ethenyl][1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl}methyl)-1H-benzotriazole |
| Molecular Weight: | 389.44 |
| Molecular Formula: | C19 H15 N7 O S |
| Smiles: | COc1ccc(/C=C/c2nn3c(Cn4c5ccccc5nn4)nnc3s2)cc1 |
| Stereo: | ACHIRAL |
| logP: | 2.4272 |
| logD: | 2.4261 |
| logSw: | -2.5208 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 68.434 |
| InChI Key: | NTJFPQNWAFMRDD-UHFFFAOYSA-N |