1-{[6-(2-ethoxyphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl}-1H-benzimidazole
Chemical Structure Depiction of
1-{[6-(2-ethoxyphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl}-1H-benzimidazole
1-{[6-(2-ethoxyphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl}-1H-benzimidazole
Compound characteristics
| Compound ID: | D064-0437 |
| Compound Name: | 1-{[6-(2-ethoxyphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl}-1H-benzimidazole |
| Molecular Weight: | 376.44 |
| Molecular Formula: | C19 H16 N6 O S |
| Smiles: | CCOc1ccccc1c1nn2c(Cn3cnc4ccccc34)nnc2s1 |
| Stereo: | ACHIRAL |
| logP: | 2.6267 |
| logD: | 1.5102 |
| logSw: | -3.1376 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 52.364 |
| InChI Key: | FZPVOIFCGDHLGJ-UHFFFAOYSA-N |