4-[4-(4-ethoxyphenyl)-5-({[3-(thiophen-2-yl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)-4H-1,2,4-triazol-3-yl]pyridine
Chemical Structure Depiction of
4-[4-(4-ethoxyphenyl)-5-({[3-(thiophen-2-yl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)-4H-1,2,4-triazol-3-yl]pyridine
4-[4-(4-ethoxyphenyl)-5-({[3-(thiophen-2-yl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)-4H-1,2,4-triazol-3-yl]pyridine
Compound characteristics
| Compound ID: | D065-0018 |
| Compound Name: | 4-[4-(4-ethoxyphenyl)-5-({[3-(thiophen-2-yl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)-4H-1,2,4-triazol-3-yl]pyridine |
| Molecular Weight: | 462.55 |
| Molecular Formula: | C22 H18 N6 O2 S2 |
| Smiles: | CCOc1ccc(cc1)n1c(c2ccncc2)nnc1SCc1nc(c2cccs2)no1 |
| Stereo: | ACHIRAL |
| logP: | 4.7176 |
| logD: | 4.7176 |
| logSw: | -4.2702 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 73.626 |
| InChI Key: | OVWBCEWVKHLYOQ-UHFFFAOYSA-N |