5-({[4-(4-methoxyphenyl)-5-methyl-4H-1,2,4-triazol-3-yl]sulfanyl}methyl)-3-(thiophen-2-yl)-1,2,4-oxadiazole
Chemical Structure Depiction of
5-({[4-(4-methoxyphenyl)-5-methyl-4H-1,2,4-triazol-3-yl]sulfanyl}methyl)-3-(thiophen-2-yl)-1,2,4-oxadiazole
5-({[4-(4-methoxyphenyl)-5-methyl-4H-1,2,4-triazol-3-yl]sulfanyl}methyl)-3-(thiophen-2-yl)-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | D065-0080 |
| Compound Name: | 5-({[4-(4-methoxyphenyl)-5-methyl-4H-1,2,4-triazol-3-yl]sulfanyl}methyl)-3-(thiophen-2-yl)-1,2,4-oxadiazole |
| Molecular Weight: | 385.46 |
| Molecular Formula: | C17 H15 N5 O2 S2 |
| Smiles: | Cc1nnc(n1c1ccc(cc1)OC)SCc1nc(c2cccs2)no1 |
| Stereo: | ACHIRAL |
| logP: | 3.4312 |
| logD: | 3.4311 |
| logSw: | -3.6149 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 65.666 |
| InChI Key: | RODKJHHMHQZTBS-UHFFFAOYSA-N |